C28H26N2O3 — CID 39951889
4-(2-oxo-1,3-benzoxazol-3-yl)-N-[[(15R)-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl]methyl]butanamide (PubChem CID 39951889) has the molecular formula C28H26N2O3 and a molecular weight of 438.53 g/mol. Its IUPAC name is 4-(2-oxo-1,3-benzoxazol-3-yl)-N-[[(15R)-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl]methyl]butanamide.
| Compound Name | 4-(2-oxo-1,3-benzoxazol-3-yl)-N-[[(15R)-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl]methyl]butanamide |
|---|---|
| PubChem CID | 39951889 |
| Molecular Formula | C28H26N2O3 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.19 |
| IUPAC Name | 4-(2-oxo-1,3-benzoxazol-3-yl)-N-[[(15R)-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl]methyl]butanamide |
| SMILES | O=C(CCCn1c(=O)oc2ccccc21)NC[C@@H]1CC2c3ccccc3C1c1ccccc12 |
| InChI | InChI=1S/C28H26N2O3/c31-26(14-7-15-30-24-12-5-6-13-25(24)33-28(30)32)29-17-18-16-23-19-8-1-3-10-21(19)27(18)22-11-4-2-9-20(22)23/h1-6,8-13,18,23,27H,7,14-17H2,(H,29,31)/t18-,23?,27?/m0/s1 |
| InChIKey | RRLWZUZWSQRLNI-QYVVGCJJSA-N |
| XLogP | 4.79 |
| TPSA | 64.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |