C33H40N4O4 — CID 3996341
N-[[3-(1-adamantyl)-1-phenylpyrazol-4-yl]methylideneamino]-3,4,5-triethoxybenzamide (PubChem CID 3996341) has the molecular formula C33H40N4O4 and a molecular weight of 556.71 g/mol. Its IUPAC name is N-[[3-(1-adamantyl)-1-phenylpyrazol-4-yl]methylideneamino]-3,4,5-triethoxybenzamide.
| Compound Name | N-[[3-(1-adamantyl)-1-phenylpyrazol-4-yl]methylideneamino]-3,4,5-triethoxybenzamide |
|---|---|
| PubChem CID | 3996341 |
| Molecular Formula | C33H40N4O4 |
| Molecular Weight | 556.71 g/mol |
| Exact Mass | 556.30 |
| IUPAC Name | N-[[3-(1-adamantyl)-1-phenylpyrazol-4-yl]methylideneamino]-3,4,5-triethoxybenzamide |
| SMILES | CCOc1cc(C(=O)NN=Cc2cn(-c3ccccc3)nc2C23CC4CC(CC(C4)C2)C3)cc(OCC)c1OCC |
| InChI | InChI=1S/C33H40N4O4/c1-4-39-28-15-25(16-29(40-5-2)30(28)41-6-3)32(38)35-34-20-26-21-37(27-10-8-7-9-11-27)36-31(26)33-17-22-12-23(18-33)14-24(13-22)19-33/h7-11,15-16,20-24H,4-6,12-14,17-19H2,1-3H3,(H,35,38) |
| InChIKey | UPGDATWMBHWBRW-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 86.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.71 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|