C36H47N3O9 — CID 3997793
3-(1,3-benzodioxol-5-ylmethyl)-1-[12-ethoxyimino-4,9-dihydroxy-15,16-bis(4-hydroxybutyl)-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraen-10-yl]-1-methylurea (PubChem CID 3997793) has the molecular formula C36H47N3O9 and a molecular weight of 665.78 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-ylmethyl)-1-[12-ethoxyimino-4,9-dihydroxy-15,16-bis(4-hydroxybutyl)-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraen-10-yl]-1-methylurea.
| Compound Name | 3-(1,3-benzodioxol-5-ylmethyl)-1-[12-ethoxyimino-4,9-dihydroxy-15,16-bis(4-hydroxybutyl)-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraen-10-yl]-1-methylurea |
|---|---|
| PubChem CID | 3997793 |
| Molecular Formula | C36H47N3O9 |
| Molecular Weight | 665.78 g/mol |
| Exact Mass | 665.33 |
| IUPAC Name | 3-(1,3-benzodioxol-5-ylmethyl)-1-[12-ethoxyimino-4,9-dihydroxy-15,16-bis(4-hydroxybutyl)-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraen-10-yl]-1-methylurea |
| SMILES | CCON=C1CC(N(C)C(=O)NCc2ccc3c(c2)OCO3)C2(O)Oc3ccc(O)cc3C3C(CCCCO)C(CCCCO)C=C1C32 |
| InChI | InChI=1S/C36H47N3O9/c1-3-47-38-28-19-32(39(2)35(43)37-20-22-10-12-30-31(16-22)46-21-45-30)36(44)34-26(28)17-23(8-4-6-14-40)25(9-5-7-15-41)33(34)27-18-24(42)11-13-29(27)48-36/h10-13,16-18,23,25,32-34,40-42,44H,3-9,14-15,19-21H2,1-2H3,(H,37,43) |
| InChIKey | BWKRTWCDAIDHHV-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 162.54 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.78 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|