C29H38N4O8 — CID 6626982
3-[(1S,9S,10S,15R,16R,17S)-12-ethoxyimino-4,9-dihydroxy-15,16-bis(4-hydroxybutyl)-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraen-10-yl]triazole-4-carboxylic acid (PubChem CID 6626982) has the molecular formula C29H38N4O8 and a molecular weight of 570.64 g/mol. Its IUPAC name is 3-[(1S,9S,10S,15R,16R,17S)-12-ethoxyimino-4,9-dihydroxy-15,16-bis(4-hydroxybutyl)-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraen-10-yl]triazole-4-carboxylic acid.
| Compound Name | 3-[(1S,9S,10S,15R,16R,17S)-12-ethoxyimino-4,9-dihydroxy-15,16-bis(4-hydroxybutyl)-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraen-10-yl]triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 6626982 |
| Molecular Formula | C29H38N4O8 |
| Molecular Weight | 570.64 g/mol |
| Exact Mass | 570.27 |
| IUPAC Name | 3-[(1S,9S,10S,15R,16R,17S)-12-ethoxyimino-4,9-dihydroxy-15,16-bis(4-hydroxybutyl)-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraen-10-yl]triazole-4-carboxylic acid |
| SMILES | CCON=C1C[C@H](n2nncc2C(=O)O)[C@@]2(O)Oc3ccc(O)cc3[C@H]3[C@H](CCCCO)[C@@H](CCCCO)C=C1[C@H]32 |
| InChI | InChI=1S/C29H38N4O8/c1-2-40-31-22-15-25(33-23(28(37)38)16-30-32-33)29(39)27-20(22)13-17(7-3-5-11-34)19(8-4-6-12-35)26(27)21-14-18(36)9-10-24(21)41-29/h9-10,13-14,16-17,19,25-27,34-36,39H,2-8,11-12,15H2,1H3,(H,37,38)/t17-,19+,25-,26+,27+,29+/m0/s1 |
| InChIKey | DAEPODMBHCGAGX-IYUAONEHSA-N |
| XLogP | 3.00 |
| TPSA | 179.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.64 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|