C33H48N4O8 — CID 3879510
10-[5-(diethoxymethyl)triazol-1-yl]-12-ethoxyimino-15,16-bis(4-hydroxybutyl)-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraene-4,9-diol (PubChem CID 3879510) has the molecular formula C33H48N4O8 and a molecular weight of 628.77 g/mol. Its IUPAC name is 10-[5-(diethoxymethyl)triazol-1-yl]-12-ethoxyimino-15,16-bis(4-hydroxybutyl)-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraene-4,9-diol.
| Compound Name | 10-[5-(diethoxymethyl)triazol-1-yl]-12-ethoxyimino-15,16-bis(4-hydroxybutyl)-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraene-4,9-diol |
|---|---|
| PubChem CID | 3879510 |
| Molecular Formula | C33H48N4O8 |
| Molecular Weight | 628.77 g/mol |
| Exact Mass | 628.35 |
| IUPAC Name | 10-[5-(diethoxymethyl)triazol-1-yl]-12-ethoxyimino-15,16-bis(4-hydroxybutyl)-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraene-4,9-diol |
| SMILES | CCON=C1CC(n2nncc2C(OCC)OCC)C2(O)Oc3ccc(O)cc3C3C(CCCCO)C(CCCCO)C=C1C32 |
| InChI | InChI=1S/C33H48N4O8/c1-4-42-32(43-5-2)27-20-34-36-37(27)29-19-26(35-44-6-3)24-17-21(11-7-9-15-38)23(12-8-10-16-39)30-25-18-22(40)13-14-28(25)45-33(29,41)31(24)30/h13-14,17-18,20-21,23,29-32,38-41H,4-12,15-16,19H2,1-3H3 |
| InChIKey | VDGKGNQENDBHGY-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 160.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.77 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|