C31H44N4O6 — CID 6627049
(1S,9S,10S,15R,16R,17S)-10-(5-butyltriazol-1-yl)-15,16-bis(4-hydroxybutyl)-12-methoxyimino-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraene-4,9-diol (PubChem CID 6627049) has the molecular formula C31H44N4O6 and a molecular weight of 568.72 g/mol. Its IUPAC name is (1S,9S,10S,15R,16R,17S)-10-(5-butyltriazol-1-yl)-15,16-bis(4-hydroxybutyl)-12-methoxyimino-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraene-4,9-diol.
| Compound Name | (1S,9S,10S,15R,16R,17S)-10-(5-butyltriazol-1-yl)-15,16-bis(4-hydroxybutyl)-12-methoxyimino-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraene-4,9-diol |
|---|---|
| PubChem CID | 6627049 |
| Molecular Formula | C31H44N4O6 |
| Molecular Weight | 568.72 g/mol |
| Exact Mass | 568.33 |
| IUPAC Name | (1S,9S,10S,15R,16R,17S)-10-(5-butyltriazol-1-yl)-15,16-bis(4-hydroxybutyl)-12-methoxyimino-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraene-4,9-diol |
| SMILES | CCCCc1cnnn1[C@H]1CC(=NOC)C2=C[C@H](CCCCO)[C@@H](CCCCO)[C@@H]3c4cc(O)ccc4O[C@@]1(O)[C@H]23 |
| InChI | InChI=1S/C31H44N4O6/c1-3-4-10-21-19-32-34-35(21)28-18-26(33-40-2)24-16-20(9-5-7-14-36)23(11-6-8-15-37)29-25-17-22(38)12-13-27(25)41-31(28,39)30(24)29/h12-13,16-17,19-20,23,28-30,36-39H,3-11,14-15,18H2,1-2H3/t20-,23+,28-,29+,30+,31+/m0/s1 |
| InChIKey | ABBDYNJBFGHEMD-RHZXKDGASA-N |
| XLogP | 4.25 |
| TPSA | 142.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.72 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|