C37H52N4O10 — CID 5213911
ditert-butyl 1-[4,9-dihydroxy-15,16-bis(4-hydroxybutyl)-12-methoxyimino-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraen-10-yl]triazole-4,5-dicarboxylate (PubChem CID 5213911) has the molecular formula C37H52N4O10 and a molecular weight of 712.84 g/mol. Its IUPAC name is ditert-butyl 1-[4,9-dihydroxy-15,16-bis(4-hydroxybutyl)-12-methoxyimino-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraen-10-yl]triazole-4,5-dicarboxylate.
| Compound Name | ditert-butyl 1-[4,9-dihydroxy-15,16-bis(4-hydroxybutyl)-12-methoxyimino-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraen-10-yl]triazole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 5213911 |
| Molecular Formula | C37H52N4O10 |
| Molecular Weight | 712.84 g/mol |
| Exact Mass | 712.37 |
| IUPAC Name | ditert-butyl 1-[4,9-dihydroxy-15,16-bis(4-hydroxybutyl)-12-methoxyimino-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraen-10-yl]triazole-4,5-dicarboxylate |
| SMILES | CON=C1CC(n2nnc(C(=O)OC(C)(C)C)c2C(=O)OC(C)(C)C)C2(O)Oc3ccc(O)cc3C3C(CCCCO)C(CCCCO)C=C1C32 |
| InChI | InChI=1S/C37H52N4O10/c1-35(2,3)50-33(45)31-32(34(46)51-36(4,5)6)41(40-38-31)28-20-26(39-48-7)24-18-21(12-8-10-16-42)23(13-9-11-17-43)29-25-19-22(44)14-15-27(25)49-37(28,47)30(24)29/h14-15,18-19,21,23,28-30,42-44,47H,8-13,16-17,20H2,1-7H3 |
| InChIKey | GYKTVXHOETVQKX-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 195.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.84 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|