C36H50N4O10 — CID 4266317
diethyl 1-[4,9-dihydroxy-15,16-bis(4-hydroxybutyl)-12-[(2-methylpropan-2-yl)oxyimino]-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraen-10-yl]triazole-4,5-dicarboxylate (PubChem CID 4266317) has the molecular formula C36H50N4O10 and a molecular weight of 698.81 g/mol. Its IUPAC name is diethyl 1-[4,9-dihydroxy-15,16-bis(4-hydroxybutyl)-12-[(2-methylpropan-2-yl)oxyimino]-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraen-10-yl]triazole-4,5-dicarboxylate.
| Compound Name | diethyl 1-[4,9-dihydroxy-15,16-bis(4-hydroxybutyl)-12-[(2-methylpropan-2-yl)oxyimino]-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraen-10-yl]triazole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 4266317 |
| Molecular Formula | C36H50N4O10 |
| Molecular Weight | 698.81 g/mol |
| Exact Mass | 698.35 |
| IUPAC Name | diethyl 1-[4,9-dihydroxy-15,16-bis(4-hydroxybutyl)-12-[(2-methylpropan-2-yl)oxyimino]-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraen-10-yl]triazole-4,5-dicarboxylate |
| SMILES | CCOC(=O)c1nnn(C2CC(=NOC(C)(C)C)C3=CC(CCCCO)C(CCCCO)C4c5cc(O)ccc5OC2(O)C34)c1C(=O)OCC |
| InChI | InChI=1S/C36H50N4O10/c1-6-47-33(44)31-32(34(45)48-7-2)40(39-37-31)28-20-26(38-50-35(3,4)5)24-18-21(12-8-10-16-41)23(13-9-11-17-42)29-25-19-22(43)14-15-27(25)49-36(28,46)30(24)29/h14-15,18-19,21,23,28-30,41-43,46H,6-13,16-17,20H2,1-5H3 |
| InChIKey | UYJYLUZRQKGEQB-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 195.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.81 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|