C32H42N4O10 — CID 3401923
1-[4,9-dihydroxy-15,16-bis(4-hydroxybutyl)-12-[(2-methylpropan-2-yl)oxyimino]-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraen-10-yl]triazole-4,5-dicarboxylic acid (PubChem CID 3401923) has the molecular formula C32H42N4O10 and a molecular weight of 642.71 g/mol. Its IUPAC name is 1-[4,9-dihydroxy-15,16-bis(4-hydroxybutyl)-12-[(2-methylpropan-2-yl)oxyimino]-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraen-10-yl]triazole-4,5-dicarboxylic acid.
| Compound Name | 1-[4,9-dihydroxy-15,16-bis(4-hydroxybutyl)-12-[(2-methylpropan-2-yl)oxyimino]-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraen-10-yl]triazole-4,5-dicarboxylic acid |
|---|---|
| PubChem CID | 3401923 |
| Molecular Formula | C32H42N4O10 |
| Molecular Weight | 642.71 g/mol |
| Exact Mass | 642.29 |
| IUPAC Name | 1-[4,9-dihydroxy-15,16-bis(4-hydroxybutyl)-12-[(2-methylpropan-2-yl)oxyimino]-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraen-10-yl]triazole-4,5-dicarboxylic acid |
| SMILES | CC(C)(C)ON=C1CC(n2nnc(C(=O)O)c2C(=O)O)C2(O)Oc3ccc(O)cc3C3C(CCCCO)C(CCCCO)C=C1C32 |
| InChI | InChI=1S/C32H42N4O10/c1-31(2,3)46-34-22-16-24(36-28(30(42)43)27(29(40)41)33-35-36)32(44)26-20(22)14-17(8-4-6-12-37)19(9-5-7-13-38)25(26)21-15-18(39)10-11-23(21)45-32/h10-11,14-15,17,19,24-26,37-39,44H,4-9,12-13,16H2,1-3H3,(H,40,41)(H,42,43) |
| InChIKey | GYCBPRJBVYPIQL-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 217.05 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.71 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|