C39H48N4O10 — CID 4207650
diethyl 1-[4,9-dihydroxy-15,16-bis(4-hydroxybutyl)-12-phenylmethoxyimino-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraen-10-yl]triazole-4,5-dicarboxylate (PubChem CID 4207650) has the molecular formula C39H48N4O10 and a molecular weight of 732.83 g/mol. Its IUPAC name is diethyl 1-[4,9-dihydroxy-15,16-bis(4-hydroxybutyl)-12-phenylmethoxyimino-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraen-10-yl]triazole-4,5-dicarboxylate.
| Compound Name | diethyl 1-[4,9-dihydroxy-15,16-bis(4-hydroxybutyl)-12-phenylmethoxyimino-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraen-10-yl]triazole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 4207650 |
| Molecular Formula | C39H48N4O10 |
| Molecular Weight | 732.83 g/mol |
| Exact Mass | 732.34 |
| IUPAC Name | diethyl 1-[4,9-dihydroxy-15,16-bis(4-hydroxybutyl)-12-phenylmethoxyimino-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraen-10-yl]triazole-4,5-dicarboxylate |
| SMILES | CCOC(=O)c1nnn(C2CC(=NOCc3ccccc3)C3=CC(CCCCO)C(CCCCO)C4c5cc(O)ccc5OC2(O)C34)c1C(=O)OCC |
| InChI | InChI=1S/C39H48N4O10/c1-3-50-37(47)35-36(38(48)51-4-2)43(42-40-35)32-22-30(41-52-23-24-12-6-5-7-13-24)28-20-25(14-8-10-18-44)27(15-9-11-19-45)33-29-21-26(46)16-17-31(29)53-39(32,49)34(28)33/h5-7,12-13,16-17,20-21,25,27,32-34,44-46,49H,3-4,8-11,14-15,18-19,22-23H2,1-2H3 |
| InChIKey | XSVOINWPIDDKLT-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 195.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.83 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|