C36H49N3O7 — CID 3576309
1-[4,9-dihydroxy-15,16-bis(4-hydroxybutyl)-12-phenylmethoxyimino-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraen-10-yl]-1-methyl-3-propylurea (PubChem CID 3576309) has the molecular formula C36H49N3O7 and a molecular weight of 635.80 g/mol. Its IUPAC name is 1-[4,9-dihydroxy-15,16-bis(4-hydroxybutyl)-12-phenylmethoxyimino-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraen-10-yl]-1-methyl-3-propylurea.
| Compound Name | 1-[4,9-dihydroxy-15,16-bis(4-hydroxybutyl)-12-phenylmethoxyimino-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraen-10-yl]-1-methyl-3-propylurea |
|---|---|
| PubChem CID | 3576309 |
| Molecular Formula | C36H49N3O7 |
| Molecular Weight | 635.80 g/mol |
| Exact Mass | 635.36 |
| IUPAC Name | 1-[4,9-dihydroxy-15,16-bis(4-hydroxybutyl)-12-phenylmethoxyimino-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraen-10-yl]-1-methyl-3-propylurea |
| SMILES | CCCNC(=O)N(C)C1CC(=NOCc2ccccc2)C2=CC(CCCCO)C(CCCCO)C3c4cc(O)ccc4OC1(O)C23 |
| InChI | InChI=1S/C36H49N3O7/c1-3-17-37-35(43)39(2)32-22-30(38-45-23-24-11-5-4-6-12-24)28-20-25(13-7-9-18-40)27(14-8-10-19-41)33-29-21-26(42)15-16-31(29)46-36(32,44)34(28)33/h4-6,11-12,15-16,20-21,25,27,32-34,40-42,44H,3,7-10,13-14,17-19,22-23H2,1-2H3,(H,37,43) |
| InChIKey | ZHXYXWCGJFLBMZ-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 144.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.80 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|