C31H47N3O7 — CID 3997868
1-[12-ethoxyimino-4,9-dihydroxy-15,16-bis(4-hydroxybutyl)-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraen-10-yl]-1-methyl-3-propylurea (PubChem CID 3997868) has the molecular formula C31H47N3O7 and a molecular weight of 573.73 g/mol. Its IUPAC name is 1-[12-ethoxyimino-4,9-dihydroxy-15,16-bis(4-hydroxybutyl)-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraen-10-yl]-1-methyl-3-propylurea.
| Compound Name | 1-[12-ethoxyimino-4,9-dihydroxy-15,16-bis(4-hydroxybutyl)-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraen-10-yl]-1-methyl-3-propylurea |
|---|---|
| PubChem CID | 3997868 |
| Molecular Formula | C31H47N3O7 |
| Molecular Weight | 573.73 g/mol |
| Exact Mass | 573.34 |
| IUPAC Name | 1-[12-ethoxyimino-4,9-dihydroxy-15,16-bis(4-hydroxybutyl)-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraen-10-yl]-1-methyl-3-propylurea |
| SMILES | CCCNC(=O)N(C)C1CC(=NOCC)C2=CC(CCCCO)C(CCCCO)C3c4cc(O)ccc4OC1(O)C23 |
| InChI | InChI=1S/C31H47N3O7/c1-4-14-32-30(38)34(3)27-19-25(33-40-5-2)23-17-20(10-6-8-15-35)22(11-7-9-16-36)28-24-18-21(37)12-13-26(24)41-31(27,39)29(23)28/h12-13,17-18,20,22,27-29,35-37,39H,4-11,14-16,19H2,1-3H3,(H,32,38) |
| InChIKey | ZWCBYSSPUWOOPO-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 144.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.73 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|