C30H45N3O7 — CID 6627109
1-[(1S,9S,10S,15R,16R,17S)-4,9-dihydroxy-15,16-bis(4-hydroxybutyl)-12-methoxyimino-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraen-10-yl]-1-methyl-3-propylurea (PubChem CID 6627109) has the molecular formula C30H45N3O7 and a molecular weight of 559.70 g/mol. Its IUPAC name is 1-[(1S,9S,10S,15R,16R,17S)-4,9-dihydroxy-15,16-bis(4-hydroxybutyl)-12-methoxyimino-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraen-10-yl]-1-methyl-3-propylurea.
| Compound Name | 1-[(1S,9S,10S,15R,16R,17S)-4,9-dihydroxy-15,16-bis(4-hydroxybutyl)-12-methoxyimino-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraen-10-yl]-1-methyl-3-propylurea |
|---|---|
| PubChem CID | 6627109 |
| Molecular Formula | C30H45N3O7 |
| Molecular Weight | 559.70 g/mol |
| Exact Mass | 559.33 |
| IUPAC Name | 1-[(1S,9S,10S,15R,16R,17S)-4,9-dihydroxy-15,16-bis(4-hydroxybutyl)-12-methoxyimino-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraen-10-yl]-1-methyl-3-propylurea |
| SMILES | CCCNC(=O)N(C)[C@H]1CC(=NOC)C2=C[C@H](CCCCO)[C@@H](CCCCO)[C@@H]3c4cc(O)ccc4O[C@@]1(O)[C@H]23 |
| InChI | InChI=1S/C30H45N3O7/c1-4-13-31-29(37)33(2)26-18-24(32-39-3)22-16-19(9-5-7-14-34)21(10-6-8-15-35)27-23-17-20(36)11-12-25(23)40-30(26,38)28(22)27/h11-12,16-17,19,21,26-28,34-36,38H,4-10,13-15,18H2,1-3H3,(H,31,37)/t19-,21+,26-,27+,28+,30+/m0/s1 |
| InChIKey | KELZTVBIEHARCU-VMCHVNEXSA-N |
| XLogP | 3.50 |
| TPSA | 144.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.70 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|