C38H56N4O9 — CID 3993397
1-[4,9-dihydroxy-15,16-bis(4-hydroxybutyl)-12-(oxan-2-yloxyimino)-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraen-10-yl]-1-methyl-3-[3-(2-oxopyrrolidin-1-yl)propyl]urea (PubChem CID 3993397) has the molecular formula C38H56N4O9 and a molecular weight of 712.88 g/mol. Its IUPAC name is 1-[4,9-dihydroxy-15,16-bis(4-hydroxybutyl)-12-(oxan-2-yloxyimino)-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraen-10-yl]-1-methyl-3-[3-(2-oxopyrrolidin-1-yl)propyl]urea.
| Compound Name | 1-[4,9-dihydroxy-15,16-bis(4-hydroxybutyl)-12-(oxan-2-yloxyimino)-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraen-10-yl]-1-methyl-3-[3-(2-oxopyrrolidin-1-yl)propyl]urea |
|---|---|
| PubChem CID | 3993397 |
| Molecular Formula | C38H56N4O9 |
| Molecular Weight | 712.88 g/mol |
| Exact Mass | 712.40 |
| IUPAC Name | 1-[4,9-dihydroxy-15,16-bis(4-hydroxybutyl)-12-(oxan-2-yloxyimino)-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraen-10-yl]-1-methyl-3-[3-(2-oxopyrrolidin-1-yl)propyl]urea |
| SMILES | CN(C(=O)NCCCN1CCCC1=O)C1CC(=NOC2CCCCO2)C2=CC(CCCCO)C(CCCCO)C3c4cc(O)ccc4OC1(O)C23 |
| InChI | InChI=1S/C38H56N4O9/c1-41(37(47)39-16-9-18-42-17-8-12-33(42)46)32-24-30(40-51-34-13-4-7-21-49-34)28-22-25(10-2-5-19-43)27(11-3-6-20-44)35-29-23-26(45)14-15-31(29)50-38(32,48)36(28)35/h14-15,22-23,25,27,32,34-36,43-45,48H,2-13,16-21,24H2,1H3,(H,39,47) |
| InChIKey | BLOMFEFRRAPTMP-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 173.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 51 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.88 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|