C37H46N4O7 — CID 5213903
15,16-bis(4-hydroxybutyl)-12-(oxan-2-yloxyimino)-10-(5-phenyltriazol-1-yl)-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraene-4,9-diol (PubChem CID 5213903) has the molecular formula C37H46N4O7 and a molecular weight of 658.80 g/mol. Its IUPAC name is 15,16-bis(4-hydroxybutyl)-12-(oxan-2-yloxyimino)-10-(5-phenyltriazol-1-yl)-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraene-4,9-diol.
| Compound Name | 15,16-bis(4-hydroxybutyl)-12-(oxan-2-yloxyimino)-10-(5-phenyltriazol-1-yl)-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraene-4,9-diol |
|---|---|
| PubChem CID | 5213903 |
| Molecular Formula | C37H46N4O7 |
| Molecular Weight | 658.80 g/mol |
| Exact Mass | 658.34 |
| IUPAC Name | 15,16-bis(4-hydroxybutyl)-12-(oxan-2-yloxyimino)-10-(5-phenyltriazol-1-yl)-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraene-4,9-diol |
| SMILES | OCCCCC1C=C2C(=NOC3CCCCO3)CC(n3nncc3-c3ccccc3)C3(O)Oc4ccc(O)cc4C(C1CCCCO)C23 |
| InChI | InChI=1S/C37H46N4O7/c42-17-7-4-12-25-20-28-30(39-48-34-14-6-9-19-46-34)22-33(41-31(23-38-40-41)24-10-2-1-3-11-24)37(45)36(28)35(27(25)13-5-8-18-43)29-21-26(44)15-16-32(29)47-37/h1-3,10-11,15-16,20-21,23,25,27,33-36,42-45H,4-9,12-14,17-19,22H2 |
| InChIKey | LRUAZXZIKJLFSY-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 151.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.80 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|