C33H46N4O8 — CID 3902038
12-ethoxyimino-15,16-bis(4-hydroxybutyl)-10-[5-(oxan-2-yloxy)triazol-1-yl]-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraene-4,9-diol (PubChem CID 3902038) has the molecular formula C33H46N4O8 and a molecular weight of 626.75 g/mol. Its IUPAC name is 12-ethoxyimino-15,16-bis(4-hydroxybutyl)-10-[5-(oxan-2-yloxy)triazol-1-yl]-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraene-4,9-diol.
| Compound Name | 12-ethoxyimino-15,16-bis(4-hydroxybutyl)-10-[5-(oxan-2-yloxy)triazol-1-yl]-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraene-4,9-diol |
|---|---|
| PubChem CID | 3902038 |
| Molecular Formula | C33H46N4O8 |
| Molecular Weight | 626.75 g/mol |
| Exact Mass | 626.33 |
| IUPAC Name | 12-ethoxyimino-15,16-bis(4-hydroxybutyl)-10-[5-(oxan-2-yloxy)triazol-1-yl]-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraene-4,9-diol |
| SMILES | CCON=C1CC(n2nncc2OC2CCCCO2)C2(O)Oc3ccc(O)cc3C3C(CCCCO)C(CCCCO)C=C1C32 |
| InChI | InChI=1S/C33H46N4O8/c1-2-43-35-26-19-28(37-29(20-34-36-37)44-30-11-5-8-16-42-30)33(41)32-24(26)17-21(9-3-6-14-38)23(10-4-7-15-39)31(32)25-18-22(40)12-13-27(25)45-33/h12-13,17-18,20-21,23,28,30-32,38-41H,2-11,14-16,19H2,1H3 |
| InChIKey | UQUOVIQOWZWQLR-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 160.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.75 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|