C32H42N4O9 — CID 5213902
3-[4,9-dihydroxy-15,16-bis(4-hydroxybutyl)-12-(oxan-2-yloxyimino)-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraen-10-yl]triazole-4-carboxylic acid (PubChem CID 5213902) has the molecular formula C32H42N4O9 and a molecular weight of 626.71 g/mol. Its IUPAC name is 3-[4,9-dihydroxy-15,16-bis(4-hydroxybutyl)-12-(oxan-2-yloxyimino)-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraen-10-yl]triazole-4-carboxylic acid.
| Compound Name | 3-[4,9-dihydroxy-15,16-bis(4-hydroxybutyl)-12-(oxan-2-yloxyimino)-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraen-10-yl]triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 5213902 |
| Molecular Formula | C32H42N4O9 |
| Molecular Weight | 626.71 g/mol |
| Exact Mass | 626.30 |
| IUPAC Name | 3-[4,9-dihydroxy-15,16-bis(4-hydroxybutyl)-12-(oxan-2-yloxyimino)-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraen-10-yl]triazole-4-carboxylic acid |
| SMILES | O=C(O)c1cnnn1C1CC(=NOC2CCCCO2)C2=CC(CCCCO)C(CCCCO)C3c4cc(O)ccc4OC1(O)C23 |
| InChI | InChI=1S/C32H42N4O9/c37-12-4-1-7-19-15-22-24(34-45-28-9-3-6-14-43-28)17-27(36-25(31(40)41)18-33-35-36)32(42)30(22)29(21(19)8-2-5-13-38)23-16-20(39)10-11-26(23)44-32/h10-11,15-16,18-19,21,27-30,37-39,42H,1-9,12-14,17H2,(H,40,41) |
| InChIKey | RBLNHEYNVVAFNT-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 188.98 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.71 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|