C36H46N4O6 — CID 3264464
15,16-bis(4-hydroxybutyl)-12-[(2-methylpropan-2-yl)oxyimino]-10-(5-phenyltriazol-1-yl)-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraene-4,9-diol (PubChem CID 3264464) has the molecular formula C36H46N4O6 and a molecular weight of 630.79 g/mol. Its IUPAC name is 15,16-bis(4-hydroxybutyl)-12-[(2-methylpropan-2-yl)oxyimino]-10-(5-phenyltriazol-1-yl)-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraene-4,9-diol.
| Compound Name | 15,16-bis(4-hydroxybutyl)-12-[(2-methylpropan-2-yl)oxyimino]-10-(5-phenyltriazol-1-yl)-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraene-4,9-diol |
|---|---|
| PubChem CID | 3264464 |
| Molecular Formula | C36H46N4O6 |
| Molecular Weight | 630.79 g/mol |
| Exact Mass | 630.34 |
| IUPAC Name | 15,16-bis(4-hydroxybutyl)-12-[(2-methylpropan-2-yl)oxyimino]-10-(5-phenyltriazol-1-yl)-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraene-4,9-diol |
| SMILES | CC(C)(C)ON=C1CC(n2nncc2-c2ccccc2)C2(O)Oc3ccc(O)cc3C3C(CCCCO)C(CCCCO)C=C1C32 |
| InChI | InChI=1S/C36H46N4O6/c1-35(2,3)46-38-29-21-32(40-30(22-37-39-40)23-11-5-4-6-12-23)36(44)34-27(29)19-24(13-7-9-17-41)26(14-8-10-18-42)33(34)28-20-25(43)15-16-31(28)45-36/h4-6,11-12,15-16,19-20,22,24,26,32-34,41-44H,7-10,13-14,17-18,21H2,1-3H3 |
| InChIKey | FCFYPWZFCCDCOD-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 142.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.79 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|