C24H25ClN4O5S2 — CID 4002334
[3-cyano-3-(1,3-dimethylbenzimidazol-2-ylidene)-2-oxopropyl] 2-[(4-chlorophenyl)sulfonylamino]-4-methylsulfanylbutanoate (PubChem CID 4002334) has the molecular formula C24H25ClN4O5S2 and a molecular weight of 549.07 g/mol. Its IUPAC name is [3-cyano-3-(1,3-dimethylbenzimidazol-2-ylidene)-2-oxopropyl] 2-[(4-chlorophenyl)sulfonylamino]-4-methylsulfanylbutanoate.
| Compound Name | [3-cyano-3-(1,3-dimethylbenzimidazol-2-ylidene)-2-oxopropyl] 2-[(4-chlorophenyl)sulfonylamino]-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 4002334 |
| Molecular Formula | C24H25ClN4O5S2 |
| Molecular Weight | 549.07 g/mol |
| Exact Mass | 548.10 |
| IUPAC Name | [3-cyano-3-(1,3-dimethylbenzimidazol-2-ylidene)-2-oxopropyl] 2-[(4-chlorophenyl)sulfonylamino]-4-methylsulfanylbutanoate |
| SMILES | CSCCC(NS(=O)(=O)c1ccc(Cl)cc1)C(=O)OCC(=O)C(C#N)=C1N(C)c2ccccc2N1C |
| InChI | InChI=1S/C24H25ClN4O5S2/c1-28-20-6-4-5-7-21(20)29(2)23(28)18(14-26)22(30)15-34-24(31)19(12-13-35-3)27-36(32,33)17-10-8-16(25)9-11-17/h4-11,19,27H,12-13,15H2,1-3H3 |
| InChIKey | FRQCXZJIUDMLMJ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 119.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.07 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|