C25H26N4O3 — CID 4016203
5-amino-2-butoxy-7-(3-methoxy-4-methylphenyl)-4-phenyl-7H-[1,3]oxazolo[5,4-b]pyridine-6-carbonitrile (PubChem CID 4016203) has the molecular formula C25H26N4O3 and a molecular weight of 430.51 g/mol. Its IUPAC name is 5-amino-2-butoxy-7-(3-methoxy-4-methylphenyl)-4-phenyl-7H-[1,3]oxazolo[5,4-b]pyridine-6-carbonitrile.
| Compound Name | 5-amino-2-butoxy-7-(3-methoxy-4-methylphenyl)-4-phenyl-7H-[1,3]oxazolo[5,4-b]pyridine-6-carbonitrile |
|---|---|
| PubChem CID | 4016203 |
| Molecular Formula | C25H26N4O3 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | 5-amino-2-butoxy-7-(3-methoxy-4-methylphenyl)-4-phenyl-7H-[1,3]oxazolo[5,4-b]pyridine-6-carbonitrile |
| SMILES | CCCCOc1nc2c(o1)N(c1ccccc1)C(N)=C(C#N)C2c1ccc(C)c(OC)c1 |
| InChI | InChI=1S/C25H26N4O3/c1-4-5-13-31-25-28-22-21(17-12-11-16(2)20(14-17)30-3)19(15-26)23(27)29(24(22)32-25)18-9-7-6-8-10-18/h6-12,14,21H,4-5,13,27H2,1-3H3 |
| InChIKey | HZOFOPBIIGQXRU-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|