C21H23N3O10S2 — CID 4020245
[2-(2-methyl-5-morpholin-4-ylsulfonylanilino)-2-oxoethyl] 4-methylsulfonyl-3-nitrobenzoate (PubChem CID 4020245) has the molecular formula C21H23N3O10S2 and a molecular weight of 541.56 g/mol. Its IUPAC name is [2-(2-methyl-5-morpholin-4-ylsulfonylanilino)-2-oxoethyl] 4-methylsulfonyl-3-nitrobenzoate.
| Compound Name | [2-(2-methyl-5-morpholin-4-ylsulfonylanilino)-2-oxoethyl] 4-methylsulfonyl-3-nitrobenzoate |
|---|---|
| PubChem CID | 4020245 |
| Molecular Formula | C21H23N3O10S2 |
| Molecular Weight | 541.56 g/mol |
| Exact Mass | 541.08 |
| IUPAC Name | [2-(2-methyl-5-morpholin-4-ylsulfonylanilino)-2-oxoethyl] 4-methylsulfonyl-3-nitrobenzoate |
| SMILES | Cc1ccc(S(=O)(=O)N2CCOCC2)cc1NC(=O)COC(=O)c1ccc(S(C)(=O)=O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H23N3O10S2/c1-14-3-5-16(36(31,32)23-7-9-33-10-8-23)12-17(14)22-20(25)13-34-21(26)15-4-6-19(35(2,29)30)18(11-15)24(27)28/h3-6,11-12H,7-10,13H2,1-2H3,(H,22,25) |
| InChIKey | UHUSRQBFTNYRDU-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 179.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.56 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|