C21H15I2N3O2 — CID 4025324
2-[[4-hydroxy-3-(6-methyl-1H-benzimidazol-2-yl)phenyl]iminomethyl]-4,6-diiodophenol (PubChem CID 4025324) has the molecular formula C21H15I2N3O2 and a molecular weight of 595.18 g/mol. Its IUPAC name is 2-[[4-hydroxy-3-(6-methyl-1H-benzimidazol-2-yl)phenyl]iminomethyl]-4,6-diiodophenol.
| Compound Name | 2-[[4-hydroxy-3-(6-methyl-1H-benzimidazol-2-yl)phenyl]iminomethyl]-4,6-diiodophenol |
|---|---|
| PubChem CID | 4025324 |
| Molecular Formula | C21H15I2N3O2 |
| Molecular Weight | 595.18 g/mol |
| Exact Mass | 594.93 |
| IUPAC Name | 2-[[4-hydroxy-3-(6-methyl-1H-benzimidazol-2-yl)phenyl]iminomethyl]-4,6-diiodophenol |
| SMILES | Cc1ccc2nc(-c3cc(/N=C/c4cc(I)cc(I)c4O)ccc3O)[nH]c2c1 |
| InChI | InChI=1S/C21H15I2N3O2/c1-11-2-4-17-18(6-11)26-21(25-17)15-9-14(3-5-19(15)27)24-10-12-7-13(22)8-16(23)20(12)28/h2-10,27-28H,1H3,(H,25,26)/b24-10+ |
| InChIKey | KOORXRCFBXCLGD-YSURURNPSA-N |
| XLogP | 5.91 |
| TPSA | 81.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.18 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|