C21H26N4O2S4 — CID 4040396
2-[(5-butylsulfanyl-12-ethyl-12-methyl-11-oxa-8-thia-4,6-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5-tetraen-3-yl)sulfanyl]-N-(1,3-thiazol-2-yl)acetamide (PubChem CID 4040396) has the molecular formula C21H26N4O2S4 and a molecular weight of 494.73 g/mol. Its IUPAC name is 2-[(5-butylsulfanyl-12-ethyl-12-methyl-11-oxa-8-thia-4,6-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5-tetraen-3-yl)sulfanyl]-N-(1,3-thiazol-2-yl)acetamide.
| Compound Name | 2-[(5-butylsulfanyl-12-ethyl-12-methyl-11-oxa-8-thia-4,6-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5-tetraen-3-yl)sulfanyl]-N-(1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 4040396 |
| Molecular Formula | C21H26N4O2S4 |
| Molecular Weight | 494.73 g/mol |
| Exact Mass | 494.09 |
| IUPAC Name | 2-[(5-butylsulfanyl-12-ethyl-12-methyl-11-oxa-8-thia-4,6-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5-tetraen-3-yl)sulfanyl]-N-(1,3-thiazol-2-yl)acetamide |
| SMILES | CCCCSc1nc(SCC(=O)Nc2nccs2)c2c3c(sc2n1)COC(C)(CC)C3 |
| InChI | InChI=1S/C21H26N4O2S4/c1-4-6-8-28-20-24-17(30-12-15(26)23-19-22-7-9-29-19)16-13-10-21(3,5-2)27-11-14(13)31-18(16)25-20/h7,9H,4-6,8,10-12H2,1-3H3,(H,22,23,26) |
| InChIKey | DMPJMBBKCKHARL-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.73 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|