C20H16BrF3N2O3 — CID 4047112
4-[(2-bromo-5-ethoxy-4-hydroxyphenyl)methylidene]-5-methyl-2-[3-(trifluoromethyl)phenyl]pyrazol-3-one (PubChem CID 4047112) has the molecular formula C20H16BrF3N2O3 and a molecular weight of 469.26 g/mol. Its IUPAC name is 4-[(2-bromo-5-ethoxy-4-hydroxyphenyl)methylidene]-5-methyl-2-[3-(trifluoromethyl)phenyl]pyrazol-3-one.
| Compound Name | 4-[(2-bromo-5-ethoxy-4-hydroxyphenyl)methylidene]-5-methyl-2-[3-(trifluoromethyl)phenyl]pyrazol-3-one |
|---|---|
| PubChem CID | 4047112 |
| Molecular Formula | C20H16BrF3N2O3 |
| Molecular Weight | 469.26 g/mol |
| Exact Mass | 468.03 |
| IUPAC Name | 4-[(2-bromo-5-ethoxy-4-hydroxyphenyl)methylidene]-5-methyl-2-[3-(trifluoromethyl)phenyl]pyrazol-3-one |
| SMILES | CCOc1cc(C=C2C(=O)N(c3cccc(C(F)(F)F)c3)N=C2C)c(Br)cc1O |
| InChI | InChI=1S/C20H16BrF3N2O3/c1-3-29-18-8-12(16(21)10-17(18)27)7-15-11(2)25-26(19(15)28)14-6-4-5-13(9-14)20(22,23)24/h4-10,27H,3H2,1-2H3 |
| InChIKey | ZRXRSQUELKJYGQ-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.26 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|