C15H14N2O7S — CID 40546250
[(1R,2S,6S,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl] 3-nitrobenzenesulfonate (PubChem CID 40546250) has the molecular formula C15H14N2O7S and a molecular weight of 366.35 g/mol. Its IUPAC name is [(1R,2S,6S,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl] 3-nitrobenzenesulfonate.
| Compound Name | [(1R,2S,6S,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl] 3-nitrobenzenesulfonate |
|---|---|
| PubChem CID | 40546250 |
| Molecular Formula | C15H14N2O7S |
| Molecular Weight | 366.35 g/mol |
| Exact Mass | 366.05 |
| IUPAC Name | [(1R,2S,6S,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl] 3-nitrobenzenesulfonate |
| SMILES | O=C1[C@H]2[C@@H]3CC[C@@H](C3)[C@@H]2C(=O)N1OS(=O)(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H14N2O7S/c18-14-12-8-4-5-9(6-8)13(12)15(19)16(14)24-25(22,23)11-3-1-2-10(7-11)17(20)21/h1-3,7-9,12-13H,4-6H2/t8-,9+,12-,13-/m0/s1 |
| InChIKey | UOOBEXJRWJXLJQ-FQPOAREZSA-N |
| XLogP | 1.25 |
| TPSA | 123.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.35 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|