C38H43ClFNO3 — CID 4056999
2-(2-chloro-6-fluorophenyl)-1-[5-(1,3-dihydroisoindol-2-ylmethyl)-5,13-dihydroxy-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]ethanone (PubChem CID 4056999) has the molecular formula C38H43ClFNO3 and a molecular weight of 616.22 g/mol. Its IUPAC name is 2-(2-chloro-6-fluorophenyl)-1-[5-(1,3-dihydroisoindol-2-ylmethyl)-5,13-dihydroxy-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]ethanone.
| Compound Name | 2-(2-chloro-6-fluorophenyl)-1-[5-(1,3-dihydroisoindol-2-ylmethyl)-5,13-dihydroxy-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]ethanone |
|---|---|
| PubChem CID | 4056999 |
| Molecular Formula | C38H43ClFNO3 |
| Molecular Weight | 616.22 g/mol |
| Exact Mass | 615.29 |
| IUPAC Name | 2-(2-chloro-6-fluorophenyl)-1-[5-(1,3-dihydroisoindol-2-ylmethyl)-5,13-dihydroxy-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]ethanone |
| SMILES | CC12CCC(O)CC13C=CC1(C(C(=O)Cc4c(F)cccc4Cl)=C3)C2CCC2(C)C1CCC2(O)CN1Cc2ccccc2C1 |
| InChI | InChI=1S/C38H43ClFNO3/c1-34-13-10-26(42)19-36(34)16-17-38(28(20-36)31(43)18-27-29(39)8-5-9-30(27)40)32(34)11-14-35(2)33(38)12-15-37(35,44)23-41-21-24-6-3-4-7-25(24)22-41/h3-9,16-17,20,26,32-33,42,44H,10-15,18-19,21-23H2,1-2H3 |
| InChIKey | MUDOXNZRNKIUNP-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.22 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|