C20H20N2OS — CID 4061061
N-[2-[(2-methyl-1H-indol-3-yl)sulfanyl]ethyl]-3-phenylprop-2-enamide (PubChem CID 4061061) has the molecular formula C20H20N2OS and a molecular weight of 336.46 g/mol. Its IUPAC name is N-[2-[(2-methyl-1H-indol-3-yl)sulfanyl]ethyl]-3-phenylprop-2-enamide.
| Compound Name | N-[2-[(2-methyl-1H-indol-3-yl)sulfanyl]ethyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 4061061 |
| Molecular Formula | C20H20N2OS |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | N-[2-[(2-methyl-1H-indol-3-yl)sulfanyl]ethyl]-3-phenylprop-2-enamide |
| SMILES | Cc1[nH]c2ccccc2c1SCCNC(=O)C=Cc1ccccc1 |
| InChI | InChI=1S/C20H20N2OS/c1-15-20(17-9-5-6-10-18(17)22-15)24-14-13-21-19(23)12-11-16-7-3-2-4-8-16/h2-12,22H,13-14H2,1H3,(H,21,23) |
| InChIKey | GJNNNZVFDDUOAP-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|