C14H17N7OS — CID 136573493
1-[2-[(2-methyl-1H-indol-3-yl)sulfanyl]ethyl]-3-(2-methyltetrazol-5-yl)urea (PubChem CID 136573493) has the molecular formula C14H17N7OS and a molecular weight of 331.41 g/mol. Its IUPAC name is 1-[2-[(2-methyl-1H-indol-3-yl)sulfanyl]ethyl]-3-(2-methyltetrazol-5-yl)urea.
| Compound Name | 1-[2-[(2-methyl-1H-indol-3-yl)sulfanyl]ethyl]-3-(2-methyltetrazol-5-yl)urea |
|---|---|
| PubChem CID | 136573493 |
| Molecular Formula | C14H17N7OS |
| Molecular Weight | 331.41 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | 1-[2-[(2-methyl-1H-indol-3-yl)sulfanyl]ethyl]-3-(2-methyltetrazol-5-yl)urea |
| SMILES | Cc1[nH]c2ccccc2c1SCCNC(=O)Nc1nnn(C)n1 |
| InChI | InChI=1S/C14H17N7OS/c1-9-12(10-5-3-4-6-11(10)16-9)23-8-7-15-14(22)17-13-18-20-21(2)19-13/h3-6,16H,7-8H2,1-2H3,(H2,15,17,19,22) |
| InChIKey | YEJPFQVAVQKNMT-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.41 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|