C13H15N3O4S2 — CID 40657608
1-ethyl-2-[(3R)-2-oxooxolan-3-yl]sulfanylbenzimidazole-5-sulfonamide (PubChem CID 40657608) has the molecular formula C13H15N3O4S2 and a molecular weight of 341.41 g/mol. Its IUPAC name is 1-ethyl-2-[(3R)-2-oxooxolan-3-yl]sulfanylbenzimidazole-5-sulfonamide.
| Compound Name | 1-ethyl-2-[(3R)-2-oxooxolan-3-yl]sulfanylbenzimidazole-5-sulfonamide |
|---|---|
| PubChem CID | 40657608 |
| Molecular Formula | C13H15N3O4S2 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.05 |
| IUPAC Name | 1-ethyl-2-[(3R)-2-oxooxolan-3-yl]sulfanylbenzimidazole-5-sulfonamide |
| SMILES | CCn1c(S[C@@H]2CCOC2=O)nc2cc(S(N)(=O)=O)ccc21 |
| InChI | InChI=1S/C13H15N3O4S2/c1-2-16-10-4-3-8(22(14,18)19)7-9(10)15-13(16)21-11-5-6-20-12(11)17/h3-4,7,11H,2,5-6H2,1H3,(H2,14,18,19)/t11-/m1/s1 |
| InChIKey | DHDXXIPIYBPGFF-LLVKDONJSA-N |
| XLogP | 1.11 |
| TPSA | 104.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |