C26H35ClN2O4 — CID 4068297
4-[2,4-bis(2,2-dimethylpropyl)phenoxy]-N-(4-chloro-3-nitrophenyl)butanamide (PubChem CID 4068297) has the molecular formula C26H35ClN2O4 and a molecular weight of 475.03 g/mol. Its IUPAC name is 4-[2,4-bis(2,2-dimethylpropyl)phenoxy]-N-(4-chloro-3-nitrophenyl)butanamide.
| Compound Name | 4-[2,4-bis(2,2-dimethylpropyl)phenoxy]-N-(4-chloro-3-nitrophenyl)butanamide |
|---|---|
| PubChem CID | 4068297 |
| Molecular Formula | C26H35ClN2O4 |
| Molecular Weight | 475.03 g/mol |
| Exact Mass | 474.23 |
| IUPAC Name | 4-[2,4-bis(2,2-dimethylpropyl)phenoxy]-N-(4-chloro-3-nitrophenyl)butanamide |
| SMILES | CC(C)(C)Cc1ccc(OCCCC(=O)Nc2ccc(Cl)c([N+](=O)[O-])c2)c(CC(C)(C)C)c1 |
| InChI | InChI=1S/C26H35ClN2O4/c1-25(2,3)16-18-9-12-23(19(14-18)17-26(4,5)6)33-13-7-8-24(30)28-20-10-11-21(27)22(15-20)29(31)32/h9-12,14-15H,7-8,13,16-17H2,1-6H3,(H,28,30) |
| InChIKey | CQDZQXAHAURJSN-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.03 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|