C24H29N3O5S — CID 40780787
(3aR,4R,6R,7R,7aR)-N-benzyl-3-(3,5-dimethoxyphenyl)-6,7-dihydroxy-N-methyl-2-sulfanylidene-3a,4,5,6,7,7a-hexahydro-1H-benzimidazole-4-carboxamide (PubChem CID 40780787) has the molecular formula C24H29N3O5S and a molecular weight of 471.58 g/mol. Its IUPAC name is (3aR,4R,6R,7R,7aR)-N-benzyl-3-(3,5-dimethoxyphenyl)-6,7-dihydroxy-N-methyl-2-sulfanylidene-3a,4,5,6,7,7a-hexahydro-1H-benzimidazole-4-carboxamide.
| Compound Name | (3aR,4R,6R,7R,7aR)-N-benzyl-3-(3,5-dimethoxyphenyl)-6,7-dihydroxy-N-methyl-2-sulfanylidene-3a,4,5,6,7,7a-hexahydro-1H-benzimidazole-4-carboxamide |
|---|---|
| PubChem CID | 40780787 |
| Molecular Formula | C24H29N3O5S |
| Molecular Weight | 471.58 g/mol |
| Exact Mass | 471.18 |
| IUPAC Name | (3aR,4R,6R,7R,7aR)-N-benzyl-3-(3,5-dimethoxyphenyl)-6,7-dihydroxy-N-methyl-2-sulfanylidene-3a,4,5,6,7,7a-hexahydro-1H-benzimidazole-4-carboxamide |
| SMILES | COc1cc(OC)cc(N2C(=S)N[C@H]3[C@@H](O)[C@H](O)C[C@@H](C(=O)N(C)Cc4ccccc4)[C@H]32)c1 |
| InChI | InChI=1S/C24H29N3O5S/c1-26(13-14-7-5-4-6-8-14)23(30)18-12-19(28)22(29)20-21(18)27(24(33)25-20)15-9-16(31-2)11-17(10-15)32-3/h4-11,18-22,28-29H,12-13H2,1-3H3,(H,25,33)/t18-,19-,20-,21-,22+/m1/s1 |
| InChIKey | DMPKNRHSMKOGJP-LMYCIYFBSA-N |
| XLogP | 1.54 |
| TPSA | 94.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.58 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|