C23H25N3O5S — CID 40780791
(3aR,4R,6R,7R,7aR)-3-(1,3-benzodioxol-5-yl)-N-benzyl-6,7-dihydroxy-N-methyl-2-sulfanylidene-3a,4,5,6,7,7a-hexahydro-1H-benzimidazole-4-carboxamide (PubChem CID 40780791) has the molecular formula C23H25N3O5S and a molecular weight of 455.54 g/mol. Its IUPAC name is (3aR,4R,6R,7R,7aR)-3-(1,3-benzodioxol-5-yl)-N-benzyl-6,7-dihydroxy-N-methyl-2-sulfanylidene-3a,4,5,6,7,7a-hexahydro-1H-benzimidazole-4-carboxamide.
| Compound Name | (3aR,4R,6R,7R,7aR)-3-(1,3-benzodioxol-5-yl)-N-benzyl-6,7-dihydroxy-N-methyl-2-sulfanylidene-3a,4,5,6,7,7a-hexahydro-1H-benzimidazole-4-carboxamide |
|---|---|
| PubChem CID | 40780791 |
| Molecular Formula | C23H25N3O5S |
| Molecular Weight | 455.54 g/mol |
| Exact Mass | 455.15 |
| IUPAC Name | (3aR,4R,6R,7R,7aR)-3-(1,3-benzodioxol-5-yl)-N-benzyl-6,7-dihydroxy-N-methyl-2-sulfanylidene-3a,4,5,6,7,7a-hexahydro-1H-benzimidazole-4-carboxamide |
| SMILES | CN(Cc1ccccc1)C(=O)[C@@H]1C[C@@H](O)[C@H](O)[C@@H]2NC(=S)N(c3ccc4c(c3)OCO4)[C@@H]21 |
| InChI | InChI=1S/C23H25N3O5S/c1-25(11-13-5-3-2-4-6-13)22(29)15-10-16(27)21(28)19-20(15)26(23(32)24-19)14-7-8-17-18(9-14)31-12-30-17/h2-9,15-16,19-21,27-28H,10-12H2,1H3,(H,24,32)/t15-,16-,19-,20-,21+/m1/s1 |
| InChIKey | RVJIJMMUHAOFHQ-VQDSBOJYSA-N |
| XLogP | 1.25 |
| TPSA | 94.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.54 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|