C29H23ClN4O3S — CID 4086159
4-chloro-N-[[1-phenyl-3-(4-phenylmethoxyphenyl)pyrazol-4-yl]methylideneamino]benzenesulfonamide (PubChem CID 4086159) has the molecular formula C29H23ClN4O3S and a molecular weight of 543.05 g/mol. Its IUPAC name is 4-chloro-N-[[1-phenyl-3-(4-phenylmethoxyphenyl)pyrazol-4-yl]methylideneamino]benzenesulfonamide.
| Compound Name | 4-chloro-N-[[1-phenyl-3-(4-phenylmethoxyphenyl)pyrazol-4-yl]methylideneamino]benzenesulfonamide |
|---|---|
| PubChem CID | 4086159 |
| Molecular Formula | C29H23ClN4O3S |
| Molecular Weight | 543.05 g/mol |
| Exact Mass | 542.12 |
| IUPAC Name | 4-chloro-N-[[1-phenyl-3-(4-phenylmethoxyphenyl)pyrazol-4-yl]methylideneamino]benzenesulfonamide |
| SMILES | O=S(=O)(NN=Cc1cn(-c2ccccc2)nc1-c1ccc(OCc2ccccc2)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C29H23ClN4O3S/c30-25-13-17-28(18-14-25)38(35,36)33-31-19-24-20-34(26-9-5-2-6-10-26)32-29(24)23-11-15-27(16-12-23)37-21-22-7-3-1-4-8-22/h1-20,33H,21H2 |
| InChIKey | SJHTULIAQGCSPE-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 85.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.05 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|