C21H13N3O3S — CID 4092896
N-(1,3-benzothiazol-2-yl)-2-(1,3-dioxobenzo[de]isoquinolin-2-yl)acetamide (PubChem CID 4092896) has the molecular formula C21H13N3O3S and a molecular weight of 387.42 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-2-(1,3-dioxobenzo[de]isoquinolin-2-yl)acetamide.
| Compound Name | N-(1,3-benzothiazol-2-yl)-2-(1,3-dioxobenzo[de]isoquinolin-2-yl)acetamide |
|---|---|
| PubChem CID | 4092896 |
| Molecular Formula | C21H13N3O3S |
| Molecular Weight | 387.42 g/mol |
| Exact Mass | 387.07 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-2-(1,3-dioxobenzo[de]isoquinolin-2-yl)acetamide |
| SMILES | O=C(CN1C(=O)c2cccc3cccc(c23)C1=O)Nc1nc2ccccc2s1 |
| InChI | InChI=1S/C21H13N3O3S/c25-17(23-21-22-15-9-1-2-10-16(15)28-21)11-24-19(26)13-7-3-5-12-6-4-8-14(18(12)13)20(24)27/h1-10H,11H2,(H,22,23,25) |
| InChIKey | QCZKWWCNQWDUFD-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.42 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|