C12H18N6O5 — CID 40965026
2-[[4-amino-6-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-5-nitropyrimidin-2-yl]amino]acetic acid (PubChem CID 40965026) has the molecular formula C12H18N6O5 and a molecular weight of 326.31 g/mol. Its IUPAC name is 2-[[4-amino-6-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-5-nitropyrimidin-2-yl]amino]acetic acid.
| Compound Name | 2-[[4-amino-6-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-5-nitropyrimidin-2-yl]amino]acetic acid |
|---|---|
| PubChem CID | 40965026 |
| Molecular Formula | C12H18N6O5 |
| Molecular Weight | 326.31 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | 2-[[4-amino-6-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-5-nitropyrimidin-2-yl]amino]acetic acid |
| SMILES | C[C@@H]1CN(c2nc(NCC(=O)O)nc(N)c2[N+](=O)[O-])C[C@@H](C)O1 |
| InChI | InChI=1S/C12H18N6O5/c1-6-4-17(5-7(2)23-6)11-9(18(21)22)10(13)15-12(16-11)14-3-8(19)20/h6-7H,3-5H2,1-2H3,(H,19,20)(H3,13,14,15,16)/t6-,7-/m1/s1 |
| InChIKey | BYXJHMCZFOTLCG-RNFRBKRXSA-N |
| XLogP | 0.08 |
| TPSA | 156.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.31 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|