C24H20ClN3O4S — CID 41000614
4-chloro-3-[(2S)-2-cyano-2-pyridin-2-ylacetyl]-N-(4-methoxyphenyl)-N-prop-2-enylbenzenesulfonamide (PubChem CID 41000614) has the molecular formula C24H20ClN3O4S and a molecular weight of 481.96 g/mol. Its IUPAC name is 4-chloro-3-[(2S)-2-cyano-2-pyridin-2-ylacetyl]-N-(4-methoxyphenyl)-N-prop-2-enylbenzenesulfonamide.
| Compound Name | 4-chloro-3-[(2S)-2-cyano-2-pyridin-2-ylacetyl]-N-(4-methoxyphenyl)-N-prop-2-enylbenzenesulfonamide |
|---|---|
| PubChem CID | 41000614 |
| Molecular Formula | C24H20ClN3O4S |
| Molecular Weight | 481.96 g/mol |
| Exact Mass | 481.09 |
| IUPAC Name | 4-chloro-3-[(2S)-2-cyano-2-pyridin-2-ylacetyl]-N-(4-methoxyphenyl)-N-prop-2-enylbenzenesulfonamide |
| SMILES | C=CCN(c1ccc(OC)cc1)S(=O)(=O)c1ccc(Cl)c(C(=O)[C@H](C#N)c2ccccn2)c1 |
| InChI | InChI=1S/C24H20ClN3O4S/c1-3-14-28(17-7-9-18(32-2)10-8-17)33(30,31)19-11-12-22(25)20(15-19)24(29)21(16-26)23-6-4-5-13-27-23/h3-13,15,21H,1,14H2,2H3/t21-/m1/s1 |
| InChIKey | OCIWJJLOEIJUJR-OAQYLSRUSA-N |
| XLogP | 4.61 |
| TPSA | 100.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.96 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|