C21H18FN3O3S2 — CID 41067584
(2S)-N-[2-(5-fluoro-1H-indol-3-yl)ethyl]-2-[(5E)-5-(furan-2-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanamide (PubChem CID 41067584) has the molecular formula C21H18FN3O3S2 and a molecular weight of 443.53 g/mol. Its IUPAC name is (2S)-N-[2-(5-fluoro-1H-indol-3-yl)ethyl]-2-[(5E)-5-(furan-2-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanamide.
| Compound Name | (2S)-N-[2-(5-fluoro-1H-indol-3-yl)ethyl]-2-[(5E)-5-(furan-2-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanamide |
|---|---|
| PubChem CID | 41067584 |
| Molecular Formula | C21H18FN3O3S2 |
| Molecular Weight | 443.53 g/mol |
| Exact Mass | 443.08 |
| IUPAC Name | (2S)-N-[2-(5-fluoro-1H-indol-3-yl)ethyl]-2-[(5E)-5-(furan-2-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanamide |
| SMILES | C[C@@H](C(=O)NCCc1c[nH]c2ccc(F)cc12)N1C(=O)/C(=C\c2ccco2)SC1=S |
| InChI | InChI=1S/C21H18FN3O3S2/c1-12(25-20(27)18(30-21(25)29)10-15-3-2-8-28-15)19(26)23-7-6-13-11-24-17-5-4-14(22)9-16(13)17/h2-5,8-12,24H,6-7H2,1H3,(H,23,26)/b18-10+/t12-/m0/s1 |
| InChIKey | FXPRVNJCUPRQAD-NNLQFVHNSA-N |
| XLogP | 3.85 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.53 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|