C10H13NO3 — CID 41097833
(2S,3S)-3-azaniumyl-2-hydroxy-4-phenylbutanoate (PubChem CID 41097833) has the molecular formula C10H13NO3 and a molecular weight of 195.22 g/mol. Its IUPAC name is (2S,3S)-3-azaniumyl-2-hydroxy-4-phenylbutanoate.
| Compound Name | (2S,3S)-3-azaniumyl-2-hydroxy-4-phenylbutanoate |
|---|---|
| PubChem CID | 41097833 |
| Molecular Formula | C10H13NO3 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.09 |
| IUPAC Name | (2S,3S)-3-azaniumyl-2-hydroxy-4-phenylbutanoate |
| SMILES | [NH3+][C@@H](Cc1ccccc1)[C@H](O)C(=O)[O-] |
| InChI | InChI=1S/C10H13NO3/c11-8(9(12)10(13)14)6-7-4-2-1-3-5-7/h1-5,8-9,12H,6,11H2,(H,13,14)/t8-,9-/m0/s1 |
| InChIKey | LDSJMFGYNFIFRK-IUCAKERBSA-N |
| XLogP | -2.05 |
| TPSA | 88.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | -2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |