C18H17O6P-2 — CID 8022878
(2R)-2-[[(1S)-1-carboxylato-2-phenylethyl]-hydroxyphosphoryl]-3-phenylpropanoate (PubChem CID 8022878) has the molecular formula C18H17O6P-2 and a molecular weight of 360.30 g/mol. Its IUPAC name is (2R)-2-[[(1S)-1-carboxylato-2-phenylethyl]-hydroxyphosphoryl]-3-phenylpropanoate.
| Compound Name | (2R)-2-[[(1S)-1-carboxylato-2-phenylethyl]-hydroxyphosphoryl]-3-phenylpropanoate |
|---|---|
| PubChem CID | 8022878 |
| Molecular Formula | C18H17O6P-2 |
| Molecular Weight | 360.30 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | (2R)-2-[[(1S)-1-carboxylato-2-phenylethyl]-hydroxyphosphoryl]-3-phenylpropanoate |
| SMILES | O=C([O-])[C@@H](Cc1ccccc1)P(=O)(O)[C@@H](Cc1ccccc1)C(=O)[O-] |
| InChI | InChI=1S/C18H19O6P/c19-17(20)15(11-13-7-3-1-4-8-13)25(23,24)16(18(21)22)12-14-9-5-2-6-10-14/h1-10,15-16H,11-12H2,(H,19,20)(H,21,22)(H,23,24)/p-2/t15-,16+ |
| InChIKey | FQQUYFMJEIMMON-IYBDPMFKSA-L |
| XLogP | -0.02 |
| TPSA | 117.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.30 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|