C14H20NO5P — CID 6922092
(2S)-2-[hydroxy(morpholin-4-ium-4-ylmethyl)phosphoryl]-3-phenylpropanoate (PubChem CID 6922092) has the molecular formula C14H20NO5P and a molecular weight of 313.29 g/mol. Its IUPAC name is (2S)-2-[hydroxy(morpholin-4-ium-4-ylmethyl)phosphoryl]-3-phenylpropanoate.
| Compound Name | (2S)-2-[hydroxy(morpholin-4-ium-4-ylmethyl)phosphoryl]-3-phenylpropanoate |
|---|---|
| PubChem CID | 6922092 |
| Molecular Formula | C14H20NO5P |
| Molecular Weight | 313.29 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | (2S)-2-[hydroxy(morpholin-4-ium-4-ylmethyl)phosphoryl]-3-phenylpropanoate |
| SMILES | O=C([O-])[C@H](Cc1ccccc1)P(=O)(O)C[NH+]1CCOCC1 |
| InChI | InChI=1S/C14H20NO5P/c16-14(17)13(10-12-4-2-1-3-5-12)21(18,19)11-15-6-8-20-9-7-15/h1-5,13H,6-11H2,(H,16,17)(H,18,19)/t13-/m0/s1 |
| InChIKey | CGYNBKITVOIKMV-ZDUSSCGKSA-N |
| XLogP | -1.51 |
| TPSA | 91.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.29 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|