C12H16F3NO4 — CID 11220142
[(2S)-1-hydroxy-1-methoxy-3-phenylpropan-2-yl]azanium;2,2,2-trifluoroacetate (PubChem CID 11220142) has the molecular formula C12H16F3NO4 and a molecular weight of 295.26 g/mol. Its IUPAC name is [(2S)-1-hydroxy-1-methoxy-3-phenylpropan-2-yl]azanium;2,2,2-trifluoroacetate.
| Compound Name | [(2S)-1-hydroxy-1-methoxy-3-phenylpropan-2-yl]azanium;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 11220142 |
| Molecular Formula | C12H16F3NO4 |
| Molecular Weight | 295.26 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | [(2S)-1-hydroxy-1-methoxy-3-phenylpropan-2-yl]azanium;2,2,2-trifluoroacetate |
| SMILES | COC(O)[C@@H]([NH3+])Cc1ccccc1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C10H15NO2.C2HF3O2/c1-13-10(12)9(11)7-8-5-3-2-4-6-8;3-2(4,5)1(6)7/h2-6,9-10,12H,7,11H2,1H3;(H,6,7)/t9-,10?;/m0./s1 |
| InChIKey | TVZYRFFXWSSMBH-KKFCBZOWSA-N |
| XLogP | -0.90 |
| TPSA | 97.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.26 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|