C18H18N6O3S — CID 41110980
(2R)-N-(1,3-benzothiazol-2-yl)-2-(1,3-dimethyl-2,6-dioxopurin-7-yl)butanamide (PubChem CID 41110980) has the molecular formula C18H18N6O3S and a molecular weight of 398.45 g/mol. Its IUPAC name is (2R)-N-(1,3-benzothiazol-2-yl)-2-(1,3-dimethyl-2,6-dioxopurin-7-yl)butanamide.
| Compound Name | (2R)-N-(1,3-benzothiazol-2-yl)-2-(1,3-dimethyl-2,6-dioxopurin-7-yl)butanamide |
|---|---|
| PubChem CID | 41110980 |
| Molecular Formula | C18H18N6O3S |
| Molecular Weight | 398.45 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | (2R)-N-(1,3-benzothiazol-2-yl)-2-(1,3-dimethyl-2,6-dioxopurin-7-yl)butanamide |
| SMILES | CC[C@H](C(=O)Nc1nc2ccccc2s1)n1cnc2c1c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C18H18N6O3S/c1-4-11(15(25)21-17-20-10-7-5-6-8-12(10)28-17)24-9-19-14-13(24)16(26)23(3)18(27)22(14)2/h5-9,11H,4H2,1-3H3,(H,20,21,25)/t11-/m1/s1 |
| InChIKey | NPEGIXNVJJBTCB-LLVKDONJSA-N |
| XLogP | 1.63 |
| TPSA | 103.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.45 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |