C37H28F6N4O3 — CID 4113547
2-[[3-(2-methyl-4-prop-2-enoxyphenyl)-1-phenylpyrazol-4-yl]methylidene]-N,N'-bis[3-(trifluoromethyl)phenyl]propanediamide (PubChem CID 4113547) has the molecular formula C37H28F6N4O3 and a molecular weight of 690.64 g/mol. Its IUPAC name is 2-[[3-(2-methyl-4-prop-2-enoxyphenyl)-1-phenylpyrazol-4-yl]methylidene]-N,N'-bis[3-(trifluoromethyl)phenyl]propanediamide.
| Compound Name | 2-[[3-(2-methyl-4-prop-2-enoxyphenyl)-1-phenylpyrazol-4-yl]methylidene]-N,N'-bis[3-(trifluoromethyl)phenyl]propanediamide |
|---|---|
| PubChem CID | 4113547 |
| Molecular Formula | C37H28F6N4O3 |
| Molecular Weight | 690.64 g/mol |
| Exact Mass | 690.21 |
| IUPAC Name | 2-[[3-(2-methyl-4-prop-2-enoxyphenyl)-1-phenylpyrazol-4-yl]methylidene]-N,N'-bis[3-(trifluoromethyl)phenyl]propanediamide |
| SMILES | C=CCOc1ccc(-c2nn(-c3ccccc3)cc2C=C(C(=O)Nc2cccc(C(F)(F)F)c2)C(=O)Nc2cccc(C(F)(F)F)c2)c(C)c1 |
| InChI | InChI=1S/C37H28F6N4O3/c1-3-17-50-30-15-16-31(23(2)18-30)33-24(22-47(46-33)29-13-5-4-6-14-29)19-32(34(48)44-27-11-7-9-25(20-27)36(38,39)40)35(49)45-28-12-8-10-26(21-28)37(41,42)43/h3-16,18-22H,1,17H2,2H3,(H,44,48)(H,45,49) |
| InChIKey | HSFNWJQMOGRPIH-UHFFFAOYSA-N |
| XLogP | 9.11 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.64 |
| LogP ≤ 5 | 9.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|