C39H33F6N5O4S — CID 4701176
2-[[3-[3-(azepan-1-ylsulfonyl)phenyl]-1-phenylpyrazol-4-yl]methylidene]-N,N'-bis[3-(trifluoromethyl)phenyl]propanediamide (PubChem CID 4701176) has the molecular formula C39H33F6N5O4S and a molecular weight of 781.78 g/mol. Its IUPAC name is 2-[[3-[3-(azepan-1-ylsulfonyl)phenyl]-1-phenylpyrazol-4-yl]methylidene]-N,N'-bis[3-(trifluoromethyl)phenyl]propanediamide.
| Compound Name | 2-[[3-[3-(azepan-1-ylsulfonyl)phenyl]-1-phenylpyrazol-4-yl]methylidene]-N,N'-bis[3-(trifluoromethyl)phenyl]propanediamide |
|---|---|
| PubChem CID | 4701176 |
| Molecular Formula | C39H33F6N5O4S |
| Molecular Weight | 781.78 g/mol |
| Exact Mass | 781.22 |
| IUPAC Name | 2-[[3-[3-(azepan-1-ylsulfonyl)phenyl]-1-phenylpyrazol-4-yl]methylidene]-N,N'-bis[3-(trifluoromethyl)phenyl]propanediamide |
| SMILES | O=C(Nc1cccc(C(F)(F)F)c1)C(=Cc1cn(-c2ccccc2)nc1-c1cccc(S(=O)(=O)N2CCCCCC2)c1)C(=O)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C39H33F6N5O4S/c40-38(41,42)28-12-9-14-30(23-28)46-36(51)34(37(52)47-31-15-10-13-29(24-31)39(43,44)45)22-27-25-50(32-16-4-3-5-17-32)48-35(27)26-11-8-18-33(21-26)55(53,54)49-19-6-1-2-7-20-49/h3-5,8-18,21-25H,1-2,6-7,19-20H2,(H,46,51)(H,47,52) |
| InChIKey | JGIUEUOLFKNCMI-UHFFFAOYSA-N |
| XLogP | 8.80 |
| TPSA | 113.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 781.78 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|