C26H26N4O3 — CID 5065711
2-cyano-N-(2-methoxyethyl)-3-[3-(2-methyl-4-prop-2-enoxyphenyl)-1-phenylpyrazol-4-yl]prop-2-enamide (PubChem CID 5065711) has the molecular formula C26H26N4O3 and a molecular weight of 442.52 g/mol. Its IUPAC name is 2-cyano-N-(2-methoxyethyl)-3-[3-(2-methyl-4-prop-2-enoxyphenyl)-1-phenylpyrazol-4-yl]prop-2-enamide.
| Compound Name | 2-cyano-N-(2-methoxyethyl)-3-[3-(2-methyl-4-prop-2-enoxyphenyl)-1-phenylpyrazol-4-yl]prop-2-enamide |
|---|---|
| PubChem CID | 5065711 |
| Molecular Formula | C26H26N4O3 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.20 |
| IUPAC Name | 2-cyano-N-(2-methoxyethyl)-3-[3-(2-methyl-4-prop-2-enoxyphenyl)-1-phenylpyrazol-4-yl]prop-2-enamide |
| SMILES | C=CCOc1ccc(-c2nn(-c3ccccc3)cc2C=C(C#N)C(=O)NCCOC)c(C)c1 |
| InChI | InChI=1S/C26H26N4O3/c1-4-13-33-23-10-11-24(19(2)15-23)25-21(16-20(17-27)26(31)28-12-14-32-3)18-30(29-25)22-8-6-5-7-9-22/h4-11,15-16,18H,1,12-14H2,2-3H3,(H,28,31) |
| InChIKey | MNHWRYPEDVPZRQ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 89.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|