C30H29N5O2 — CID 6522055
(E)-3-[3-(4-butoxy-2-methylphenyl)-1-phenylpyrazol-4-yl]-2-cyano-N-(pyridin-3-ylmethyl)prop-2-enamide (PubChem CID 6522055) has the molecular formula C30H29N5O2 and a molecular weight of 491.60 g/mol. Its IUPAC name is (E)-3-[3-(4-butoxy-2-methylphenyl)-1-phenylpyrazol-4-yl]-2-cyano-N-(pyridin-3-ylmethyl)prop-2-enamide.
| Compound Name | (E)-3-[3-(4-butoxy-2-methylphenyl)-1-phenylpyrazol-4-yl]-2-cyano-N-(pyridin-3-ylmethyl)prop-2-enamide |
|---|---|
| PubChem CID | 6522055 |
| Molecular Formula | C30H29N5O2 |
| Molecular Weight | 491.60 g/mol |
| Exact Mass | 491.23 |
| IUPAC Name | (E)-3-[3-(4-butoxy-2-methylphenyl)-1-phenylpyrazol-4-yl]-2-cyano-N-(pyridin-3-ylmethyl)prop-2-enamide |
| SMILES | CCCCOc1ccc(-c2nn(-c3ccccc3)cc2/C=C(\C#N)C(=O)NCc2cccnc2)c(C)c1 |
| InChI | InChI=1S/C30H29N5O2/c1-3-4-15-37-27-12-13-28(22(2)16-27)29-25(21-35(34-29)26-10-6-5-7-11-26)17-24(18-31)30(36)33-20-23-9-8-14-32-19-23/h5-14,16-17,19,21H,3-4,15,20H2,1-2H3,(H,33,36)/b24-17+ |
| InChIKey | JVSNVELTHFYYDU-JJIBRWJFSA-N |
| XLogP | 5.64 |
| TPSA | 92.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.60 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|