C24H22N4O2 — CID 4689843
2-cyano-N-methyl-3-[3-(2-methyl-4-prop-2-enoxyphenyl)-1-phenylpyrazol-4-yl]prop-2-enamide (PubChem CID 4689843) has the molecular formula C24H22N4O2 and a molecular weight of 398.47 g/mol. Its IUPAC name is 2-cyano-N-methyl-3-[3-(2-methyl-4-prop-2-enoxyphenyl)-1-phenylpyrazol-4-yl]prop-2-enamide.
| Compound Name | 2-cyano-N-methyl-3-[3-(2-methyl-4-prop-2-enoxyphenyl)-1-phenylpyrazol-4-yl]prop-2-enamide |
|---|---|
| PubChem CID | 4689843 |
| Molecular Formula | C24H22N4O2 |
| Molecular Weight | 398.47 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | 2-cyano-N-methyl-3-[3-(2-methyl-4-prop-2-enoxyphenyl)-1-phenylpyrazol-4-yl]prop-2-enamide |
| SMILES | C=CCOc1ccc(-c2nn(-c3ccccc3)cc2C=C(C#N)C(=O)NC)c(C)c1 |
| InChI | InChI=1S/C24H22N4O2/c1-4-12-30-21-10-11-22(17(2)13-21)23-19(14-18(15-25)24(29)26-3)16-28(27-23)20-8-6-5-7-9-20/h4-11,13-14,16H,1,12H2,2-3H3,(H,26,29) |
| InChIKey | NXSBXIZADOEARC-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 79.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.47 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|