C37H27NOS — CID 4128472
(5-benzyl-1,4,6-triphenyl-2-sulfanylidene-3-pyridinyl)-phenylmethanone (PubChem CID 4128472) has the molecular formula C37H27NOS and a molecular weight of 533.70 g/mol. Its IUPAC name is (5-benzyl-1,4,6-triphenyl-2-sulfanylidene-3-pyridinyl)-phenylmethanone.
| Compound Name | (5-benzyl-1,4,6-triphenyl-2-sulfanylidene-3-pyridinyl)-phenylmethanone |
|---|---|
| PubChem CID | 4128472 |
| Molecular Formula | C37H27NOS |
| Molecular Weight | 533.70 g/mol |
| Exact Mass | 533.18 |
| IUPAC Name | (5-benzyl-1,4,6-triphenyl-2-sulfanylidene-3-pyridinyl)-phenylmethanone |
| SMILES | O=C(c1ccccc1)c1c(-c2ccccc2)c(Cc2ccccc2)c(-c2ccccc2)n(-c2ccccc2)c1=S |
| InChI | InChI=1S/C37H27NOS/c39-36(30-22-12-4-13-23-30)34-33(28-18-8-2-9-19-28)32(26-27-16-6-1-7-17-27)35(29-20-10-3-11-21-29)38(37(34)40)31-24-14-5-15-25-31/h1-25H,26H2 |
| InChIKey | NDJSUDBVQLAMCD-UHFFFAOYSA-N |
| XLogP | 9.36 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.70 |
| LogP ≤ 5 | 9.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|