C19H19N3O7S2 — CID 4130755
methyl 2-[[2-[[5-(furan-2-yl)-1,3,4-oxadiazol-2-yl]sulfonyl]acetyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 4130755) has the molecular formula C19H19N3O7S2 and a molecular weight of 465.51 g/mol. Its IUPAC name is methyl 2-[[2-[[5-(furan-2-yl)-1,3,4-oxadiazol-2-yl]sulfonyl]acetyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | methyl 2-[[2-[[5-(furan-2-yl)-1,3,4-oxadiazol-2-yl]sulfonyl]acetyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 4130755 |
| Molecular Formula | C19H19N3O7S2 |
| Molecular Weight | 465.51 g/mol |
| Exact Mass | 465.07 |
| IUPAC Name | methyl 2-[[2-[[5-(furan-2-yl)-1,3,4-oxadiazol-2-yl]sulfonyl]acetyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=O)CS(=O)(=O)c2nnc(-c3ccco3)o2)sc2c1CCC(C)C2 |
| InChI | InChI=1S/C19H19N3O7S2/c1-10-5-6-11-13(8-10)30-17(15(11)18(24)27-2)20-14(23)9-31(25,26)19-22-21-16(29-19)12-4-3-7-28-12/h3-4,7,10H,5-6,8-9H2,1-2H3,(H,20,23) |
| InChIKey | INGYKNITGZKDRD-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 141.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.51 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |