C20H21N3O6S3 — CID 3661683
ethyl 6-methyl-2-[[2-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)sulfonyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 3661683) has the molecular formula C20H21N3O6S3 and a molecular weight of 495.60 g/mol. Its IUPAC name is ethyl 6-methyl-2-[[2-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)sulfonyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 6-methyl-2-[[2-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)sulfonyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 3661683 |
| Molecular Formula | C20H21N3O6S3 |
| Molecular Weight | 495.60 g/mol |
| Exact Mass | 495.06 |
| IUPAC Name | ethyl 6-methyl-2-[[2-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)sulfonyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)CS(=O)(=O)c2nnc(-c3cccs3)o2)sc2c1CCC(C)C2 |
| InChI | InChI=1S/C20H21N3O6S3/c1-3-28-19(25)16-12-7-6-11(2)9-14(12)31-18(16)21-15(24)10-32(26,27)20-23-22-17(29-20)13-5-4-8-30-13/h4-5,8,11H,3,6-7,9-10H2,1-2H3,(H,21,24) |
| InChIKey | MSUIEJWVHCKDDN-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 128.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.60 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |